About 4-pyridin-4-yl-3H-1,3-thiazole-2-thione
4-pyridin-4-yl-3H-1,3-thiazole-2-thione (PubChem CID 22392870) has the molecular formula C8H6N2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-pyridin-4-yl-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-pyridin-4-yl-3H-1,3-thiazole-2-thione |
| PubChem CID | 22392870 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 4-pyridin-4-yl-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]c(-c2ccncc2)cs1 |
| InChI | InChI=1S/C8H6N2S2/c11-8-10-7(5-12-8)6-1-3-9-4-2-6/h1-5H,(H,10,11) |
| InChIKey | LEQNUYXXLYRUNY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-4-yl-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-yl-3H-1,3-thiazole-2-thione?
The IUPAC name of 4-pyridin-4-yl-3H-1,3-thiazole-2-thione (CID 22392870) is 4-pyridin-4-yl-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 4-pyridin-4-yl-3H-1,3-thiazole-2-thione?
The canonical SMILES for 4-pyridin-4-yl-3H-1,3-thiazole-2-thione is S=c1[nH]c(-c2ccncc2)cs1.
What is the InChIKey of 4-pyridin-4-yl-3H-1,3-thiazole-2-thione?
The InChIKey is LEQNUYXXLYRUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S2/c11-8-10-7(5-12-8)6-1-3-9-4-2-6/h1-5H,(H,10,11).
What are the key properties of 4-pyridin-4-yl-3H-1,3-thiazole-2-thione?
4-pyridin-4-yl-3H-1,3-thiazole-2-thione has a molecular weight of 194.28 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-yl-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 22392870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).