C11H15NO — CID 22393031
3-methyl-2,8,9,9a-tetrahydro-1H-3-benzazepin-4-one (PubChem CID 22393031) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-methyl-2,8,9,9a-tetrahydro-1H-3-benzazepin-4-one.
| Compound Name | 3-methyl-2,8,9,9a-tetrahydro-1H-3-benzazepin-4-one |
|---|---|
| PubChem CID | 22393031 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-methyl-2,8,9,9a-tetrahydro-1H-3-benzazepin-4-one |
| SMILES | CN1CCC2CCC=CC2=CC1=O |
| InChI | InChI=1S/C11H15NO/c1-12-7-6-9-4-2-3-5-10(9)8-11(12)13/h3,5,8-9H,2,4,6-7H2,1H3 |
| InChIKey | FJKQJSKFMZDNGE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |