C28H30FN5O3 — CID 22393292
1-[3,5-bis(1,2-oxazol-3-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea (PubChem CID 22393292) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is 1-[3,5-bis(1,2-oxazol-3-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea.
| Compound Name | 1-[3,5-bis(1,2-oxazol-3-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393292 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 1-[3,5-bis(1,2-oxazol-3-yl)phenyl]-3-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]urea |
| SMILES | O=C(NCCCN1CCCC(Cc2ccc(F)cc2)C1)Nc1cc(-c2ccon2)cc(-c2ccon2)c1 |
| InChI | InChI=1S/C28H30FN5O3/c29-24-6-4-20(5-7-24)15-21-3-1-11-34(19-21)12-2-10-30-28(35)31-25-17-22(26-8-13-36-32-26)16-23(18-25)27-9-14-37-33-27/h4-9,13-14,16-18,21H,1-3,10-12,15,19H2,(H2,30,31,35) |
| InChIKey | YMQKEBUJRANRGZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|