About 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine
2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine (PubChem CID 22393872) has the molecular formula C20H20F6N2O
and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine.
Molecular Properties
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine |
| PubChem CID | 22393872 |
| Molecular Formula | C20H20F6N2O |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine |
| SMILES | FC(F)(F)c1cc(COCC2NCCNC2c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F6N2O/c21-19(22,23)15-8-13(9-16(10-15)20(24,25)26)11-29-12-17-18(28-7-6-27-17)14-4-2-1-3-5-14/h1-5,8-10,17-18,27-28H,6-7,11-12H2 |
| InChIKey | NPBCGXJEGXBQSU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine?
The IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine (CID 22393872) is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine.
What is the SMILES notation for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine?
The canonical SMILES for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine is FC(F)(F)c1cc(COCC2NCCNC2c2ccccc2)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine?
The InChIKey is NPBCGXJEGXBQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F6N2O/c21-19(22,23)15-8-13(9-16(10-15)20(24,25)26)11-29-12-17-18(28-7-6-27-17)14-4-2-1-3-5-14/h1-5,8-10,17-18,27-28H,6-7,11-12H2.
What are the key properties of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine?
2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine has a molecular weight of 418.38 g/mol, XLogP of 4.54, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperazine is sourced from PubChem (CID 22393872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).