C24H20ClNO — CID 2239413
2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-6-methylchromen-4-imine (PubChem CID 2239413) has the molecular formula C24H20ClNO and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-6-methylchromen-4-imine.
| Compound Name | 2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-6-methylchromen-4-imine |
|---|---|
| PubChem CID | 2239413 |
| Molecular Formula | C24H20ClNO |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-6-methylchromen-4-imine |
| SMILES | Cc1ccc2oc(-c3ccc(Cl)cc3)c/c(=N\c3cccc(C)c3C)c2c1 |
| InChI | InChI=1S/C24H20ClNO/c1-15-7-12-23-20(13-15)22(26-21-6-4-5-16(2)17(21)3)14-24(27-23)18-8-10-19(25)11-9-18/h4-14H,1-3H3/b26-22+ |
| InChIKey | LSUJHNNWSWODCE-XTCLZLMSSA-N |
| XLogP | 6.91 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |