C19H24N4O6S — CID 22394889
N-(7-cyano-3,4-dihydroxy-1-phenylheptan-2-yl)-2-(methanesulfonamido)-1,3-oxazole-4-carboxamide (PubChem CID 22394889) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-(7-cyano-3,4-dihydroxy-1-phenylheptan-2-yl)-2-(methanesulfonamido)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(7-cyano-3,4-dihydroxy-1-phenylheptan-2-yl)-2-(methanesulfonamido)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 22394889 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(7-cyano-3,4-dihydroxy-1-phenylheptan-2-yl)-2-(methanesulfonamido)-1,3-oxazole-4-carboxamide |
| SMILES | CS(=O)(=O)Nc1nc(C(=O)NC(Cc2ccccc2)C(O)C(O)CCCC#N)co1 |
| InChI | InChI=1S/C19H24N4O6S/c1-30(27,28)23-19-22-15(12-29-19)18(26)21-14(11-13-7-3-2-4-8-13)17(25)16(24)9-5-6-10-20/h2-4,7-8,12,14,16-17,24-25H,5-6,9,11H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | TWIQPTBIJPNVOP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 165.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|