About cyclohex-3-ene-1,3-dicarboxylic acid
cyclohex-3-ene-1,3-dicarboxylic acid (PubChem CID 22394959) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is cyclohex-3-ene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | cyclohex-3-ene-1,3-dicarboxylic acid |
| PubChem CID | 22394959 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | cyclohex-3-ene-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1=CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C8H10O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h2,6H,1,3-4H2,(H,9,10)(H,11,12) |
| InChIKey | GWFATZSREPOCHH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohex-3-ene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-ene-1,3-dicarboxylic acid?
The IUPAC name of cyclohex-3-ene-1,3-dicarboxylic acid (CID 22394959) is cyclohex-3-ene-1,3-dicarboxylic acid.
What is the SMILES notation for cyclohex-3-ene-1,3-dicarboxylic acid?
The canonical SMILES for cyclohex-3-ene-1,3-dicarboxylic acid is O=C(O)C1=CCCC(C(=O)O)C1.
What is the InChIKey of cyclohex-3-ene-1,3-dicarboxylic acid?
The InChIKey is GWFATZSREPOCHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h2,6H,1,3-4H2,(H,9,10)(H,11,12).
What are the key properties of cyclohex-3-ene-1,3-dicarboxylic acid?
cyclohex-3-ene-1,3-dicarboxylic acid has a molecular weight of 170.16 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-ene-1,3-dicarboxylic acid is sourced from PubChem (CID 22394959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).