About molybdenum diphosphate
molybdenum diphosphate (PubChem CID 22395595) has the molecular formula MoO8P2-6
and a molecular weight of 285.88 g/mol. Its IUPAC name is molybdenum diphosphate.
Molecular Properties
| Compound Name | molybdenum diphosphate |
| PubChem CID | 22395595 |
| Molecular Formula | MoO8P2-6 |
| Molecular Weight | 285.88 g/mol |
| Exact Mass | 287.82 |
| IUPAC Name | molybdenum diphosphate |
| SMILES | O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Mo] |
| InChI | InChI=1S/Mo.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/p-6 |
| InChIKey | ZRFFAUKHYKAUAN-UHFFFAOYSA-H |
| XLogP | -5.65 |
| TPSA | 172.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.88 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze molybdenum diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum diphosphate?
The IUPAC name of molybdenum diphosphate (CID 22395595) is molybdenum diphosphate.
What is the SMILES notation for molybdenum diphosphate?
The canonical SMILES for molybdenum diphosphate is O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Mo].
What is the InChIKey of molybdenum diphosphate?
The InChIKey is ZRFFAUKHYKAUAN-UHFFFAOYSA-H. The full InChI is InChI=1S/Mo.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/p-6.
What are the key properties of molybdenum diphosphate?
molybdenum diphosphate has a molecular weight of 285.88 g/mol, XLogP of -5.65, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum diphosphate is sourced from PubChem (CID 22395595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).