1,1-difluoroethene fluoride

C2H2F3- — CID 22395607

IUPAC1,1-difluoroethene fluoride
SMILESC=C(F)F.[F-]
InChIInChI=1S/C2H2F2.FH/c1-2(3)4;/h1H2;1H/p-1
InChIKeyRRKBFOATFMNSPW-UHFFFAOYSA-M
MW83.03 g/mol
LogP-1.60
Rot. Bonds

About 1,1-difluoroethene fluoride

1,1-difluoroethene fluoride (PubChem CID 22395607) has the molecular formula C2H2F3- and a molecular weight of 83.03 g/mol. Its IUPAC name is 1,1-difluoroethene fluoride.

Molecular Properties

Compound Name1,1-difluoroethene fluoride
PubChem CID22395607
Molecular FormulaC2H2F3-
Molecular Weight83.03 g/mol
Exact Mass83.01
IUPAC Name1,1-difluoroethene fluoride
SMILESC=C(F)F.[F-]
InChIInChI=1S/C2H2F2.FH/c1-2(3)4;/h1H2;1H/p-1
InChIKeyRRKBFOATFMNSPW-UHFFFAOYSA-M
XLogP-1.60
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50083.03
LogP ≤ 5-1.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze 1,1-difluoroethene fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-difluoroethene fluoride?
The IUPAC name of 1,1-difluoroethene fluoride (CID 22395607) is 1,1-difluoroethene fluoride.
What is the SMILES notation for 1,1-difluoroethene fluoride?
The canonical SMILES for 1,1-difluoroethene fluoride is C=C(F)F.[F-].
What is the InChIKey of 1,1-difluoroethene fluoride?
The InChIKey is RRKBFOATFMNSPW-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2F2.FH/c1-2(3)4;/h1H2;1H/p-1.
What are the key properties of 1,1-difluoroethene fluoride?
1,1-difluoroethene fluoride has a molecular weight of 83.03 g/mol, XLogP of -1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethene fluoride is sourced from PubChem (CID 22395607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).