C8H11NO — CID 22396122
1,3,3a,4,5,6-hexahydroindol-2-one (PubChem CID 22396122) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,3,3a,4,5,6-hexahydroindol-2-one.
| Compound Name | 1,3,3a,4,5,6-hexahydroindol-2-one |
|---|---|
| PubChem CID | 22396122 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,3,3a,4,5,6-hexahydroindol-2-one |
| SMILES | O=C1CC2CCCC=C2N1 |
| InChI | InChI=1S/C8H11NO/c10-8-5-6-3-1-2-4-7(6)9-8/h4,6H,1-3,5H2,(H,9,10) |
| InChIKey | XYOTVNLEVSFRRG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |