C18H18ClFN2 — CID 22396699
10-(2-fluorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride (PubChem CID 22396699) has the molecular formula C18H18ClFN2 and a molecular weight of 316.81 g/mol. Its IUPAC name is 10-(2-fluorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride.
| Compound Name | 10-(2-fluorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
|---|---|
| PubChem CID | 22396699 |
| Molecular Formula | C18H18ClFN2 |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 10-(2-fluorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
| SMILES | Cl.Fc1ccccc1-c1cccc2[nH]c3c(c12)CCNCC3 |
| InChI | InChI=1S/C18H17FN2.ClH/c19-15-6-2-1-4-12(15)13-5-3-7-17-18(13)14-8-10-20-11-9-16(14)21-17;/h1-7,20-21H,8-11H2;1H |
| InChIKey | SSGMWGRUZYRRAY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |