C12H13FN2 — CID 22396704
8-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole (PubChem CID 22396704) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 8-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole.
| Compound Name | 8-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 22396704 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 8-fluoro-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
| SMILES | Fc1ccc2c3c([nH]c2c1)CCNCC3 |
| InChI | InChI=1S/C12H13FN2/c13-8-1-2-9-10-3-5-14-6-4-11(10)15-12(9)7-8/h1-2,7,14-15H,3-6H2 |
| InChIKey | AUYHUHPBCPKFDR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|