C18H18Cl2N4OS — CID 22396785
2-(9,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 22396785) has the molecular formula C18H18Cl2N4OS and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-(9,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(9,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 22396785 |
| Molecular Formula | C18H18Cl2N4OS |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-(9,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)Cn2c3c(c4c(Cl)c(Cl)ccc42)CCNCC3)s1 |
| InChI | InChI=1S/C18H18Cl2N4OS/c1-10-8-22-18(26-10)23-15(25)9-24-13-5-7-21-6-4-11(13)16-14(24)3-2-12(19)17(16)20/h2-3,8,21H,4-7,9H2,1H3,(H,22,23,25) |
| InChIKey | UOMCKVYOKOPWAM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |