C20H22N2O2S — CID 22396915
6-[2-(benzenesulfonyl)ethyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 22396915) has the molecular formula C20H22N2O2S and a molecular weight of 354.47 g/mol. Its IUPAC name is 6-[2-(benzenesulfonyl)ethyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 6-[2-(benzenesulfonyl)ethyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 22396915 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 6-[2-(benzenesulfonyl)ethyl]-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | O=S(=O)(CCn1c2c(c3ccccc31)CCNCC2)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2S/c23-25(24,16-6-2-1-3-7-16)15-14-22-19-9-5-4-8-17(19)18-10-12-21-13-11-20(18)22/h1-9,21H,10-15H2 |
| InChIKey | VFSPVKQRIDCDFX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|