C18H17Cl3N2 — CID 22396959
10-(3,4-dichlorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride (PubChem CID 22396959) has the molecular formula C18H17Cl3N2 and a molecular weight of 367.71 g/mol. Its IUPAC name is 10-(3,4-dichlorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride.
| Compound Name | 10-(3,4-dichlorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
|---|---|
| PubChem CID | 22396959 |
| Molecular Formula | C18H17Cl3N2 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 10-(3,4-dichlorophenyl)-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole;hydrochloride |
| SMILES | Cl.Clc1ccc(-c2cccc3[nH]c4c(c23)CCNCC4)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N2.ClH/c19-14-5-4-11(10-15(14)20)12-2-1-3-17-18(12)13-6-8-21-9-7-16(13)22-17;/h1-5,10,21-22H,6-9H2;1H |
| InChIKey | UVKMQRLJLPKTRH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |