About N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide
N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide (PubChem CID 22397026) has the molecular formula C24H21Cl2N3O2
and a molecular weight of 454.36 g/mol. Its IUPAC name is N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide |
| PubChem CID | 22397026 |
| Molecular Formula | C24H21Cl2N3O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide |
| SMILES | CCc1c(C#N)cc2ccccc2c1C(=O)NCC(CC(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2N3O2/c1-2-18-16(12-27)9-15-5-3-4-6-19(15)23(18)24(31)29-13-17(11-22(28)30)14-7-8-20(25)21(26)10-14/h3-10,17H,2,11,13H2,1H3,(H2,28,30)(H,29,31) |
| InChIKey | VGRWJSKXGMDNAK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide?
The IUPAC name of N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide (CID 22397026) is N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide.
What is the SMILES notation for N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide?
The canonical SMILES for N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide is CCc1c(C#N)cc2ccccc2c1C(=O)NCC(CC(N)=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide?
The InChIKey is VGRWJSKXGMDNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2N3O2/c1-2-18-16(12-27)9-15-5-3-4-6-19(15)23(18)24(31)29-13-17(11-22(28)30)14-7-8-20(25)21(26)10-14/h3-10,17H,2,11,13H2,1H3,(H2,28,30)(H,29,31).
What are the key properties of N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide?
N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide has a molecular weight of 454.36 g/mol, XLogP of 4.97, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-amino-2-(3,4-dichlorophenyl)-4-oxobutyl]-3-cyano-2-ethylnaphthalene-1-carboxamide is sourced from PubChem (CID 22397026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).