About 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide
4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 22397234) has the molecular formula C8H6N4O2
and a molecular weight of 190.16 g/mol. Its IUPAC name is 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide |
| PubChem CID | 22397234 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1cnc2ncccn2c1=O |
| InChI | InChI=1S/C8H6N4O2/c9-6(13)5-4-11-8-10-2-1-3-12(8)7(5)14/h1-4H,(H2,9,13) |
| InChIKey | GDARTZASXHXMQQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide?
The IUPAC name of 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide (CID 22397234) is 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide.
What is the SMILES notation for 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide?
The canonical SMILES for 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide is NC(=O)c1cnc2ncccn2c1=O.
What is the InChIKey of 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide?
The InChIKey is GDARTZASXHXMQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2/c9-6(13)5-4-11-8-10-2-1-3-12(8)7(5)14/h1-4H,(H2,9,13).
What are the key properties of 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide?
4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide has a molecular weight of 190.16 g/mol, XLogP of -0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopyrimido[1,2-a]pyrimidine-3-carboxamide is sourced from PubChem (CID 22397234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).