C20H19Cl2N5O2 — CID 22397577
(2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(dimethylamino)pyrimidin-5-yl]-2-methoxypenta-2,4-dienamide (PubChem CID 22397577) has the molecular formula C20H19Cl2N5O2 and a molecular weight of 432.31 g/mol. Its IUPAC name is (2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(dimethylamino)pyrimidin-5-yl]-2-methoxypenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(dimethylamino)pyrimidin-5-yl]-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 22397577 |
| Molecular Formula | C20H19Cl2N5O2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(dimethylamino)pyrimidin-5-yl]-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C/C=C/c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)Nc1cnc(N(C)C)nc1 |
| InChI | InChI=1S/C20H19Cl2N5O2/c1-27(2)20-23-10-14(11-24-20)26-19(28)18(29-3)6-4-5-13-7-12-8-15(21)16(22)9-17(12)25-13/h4-11,25H,1-3H3,(H,26,28)/b5-4+,18-6+ |
| InChIKey | YSPWYKPXRLQGIL-AHEGLGOKSA-N |
| XLogP | 4.51 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|