C27H29Cl3N4O2 — CID 22397580
(2Z,4E)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 22397580) has the molecular formula C27H29Cl3N4O2 and a molecular weight of 547.91 g/mol. Its IUPAC name is (2Z,4E)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 22397580 |
| Molecular Formula | C27H29Cl3N4O2 |
| Molecular Weight | 547.91 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | (2Z,4E)-N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C27H29Cl3N4O2/c1-36-26(8-3-6-21-15-19-16-23(29)24(30)18-25(19)32-21)27(35)31-9-4-10-33-11-13-34(14-12-33)22-7-2-5-20(28)17-22/h2-3,5-8,15-18,32H,4,9-14H2,1H3,(H,31,35)/b6-3+,26-8- |
| InChIKey | NSBQENQQQQIUNL-CYWZBKSPSA-N |
| XLogP | 6.00 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.91 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|