C23H28Cl2N4O2 — CID 22397596
(2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-(3,7-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 22397596) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-(3,7-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-(3,7-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 22397596 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-(3,7-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NC1C2CN(C)CC1CN(C)C2 |
| InChI | InChI=1S/C23H28Cl2N4O2/c1-28-10-15-12-29(2)13-16(11-28)22(15)27-23(30)21(31-3)6-4-5-17-7-14-8-18(24)19(25)9-20(14)26-17/h4-9,15-16,22,26H,10-13H2,1-3H3,(H,27,30)/b5-4+,21-6- |
| InChIKey | YIKHZCFWRWIEEJ-LXMZQHMWSA-N |
| XLogP | 3.63 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|