About 2,2,6,6-tetramethylpiperidin-4-one;hydrate
2,2,6,6-tetramethylpiperidin-4-one;hydrate (PubChem CID 22397602) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,2,6,6-tetramethylpiperidin-4-one;hydrate.
Molecular Properties
| Compound Name | 2,2,6,6-tetramethylpiperidin-4-one;hydrate |
| PubChem CID | 22397602 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2,2,6,6-tetramethylpiperidin-4-one;hydrate |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1.O |
| InChI | InChI=1S/C9H17NO.H2O/c1-8(2)5-7(11)6-9(3,4)10-8;/h10H,5-6H2,1-4H3;1H2 |
| InChIKey | SFDODBGIDPNFEH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,6,6-tetramethylpiperidin-4-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,6,6-tetramethylpiperidin-4-one;hydrate?
The IUPAC name of 2,2,6,6-tetramethylpiperidin-4-one;hydrate (CID 22397602) is 2,2,6,6-tetramethylpiperidin-4-one;hydrate.
What is the SMILES notation for 2,2,6,6-tetramethylpiperidin-4-one;hydrate?
The canonical SMILES for 2,2,6,6-tetramethylpiperidin-4-one;hydrate is CC1(C)CC(=O)CC(C)(C)N1.O.
What is the InChIKey of 2,2,6,6-tetramethylpiperidin-4-one;hydrate?
The InChIKey is SFDODBGIDPNFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.H2O/c1-8(2)5-7(11)6-9(3,4)10-8;/h10H,5-6H2,1-4H3;1H2.
What are the key properties of 2,2,6,6-tetramethylpiperidin-4-one;hydrate?
2,2,6,6-tetramethylpiperidin-4-one;hydrate has a molecular weight of 173.26 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,6,6-tetramethylpiperidin-4-one;hydrate is sourced from PubChem (CID 22397602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).