C15H17N — CID 22397616
(10Z)-8-azatricyclo[10.4.0.02,7]hexadeca-3,5,10,13,15-pentaene (PubChem CID 22397616) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (10Z)-8-azatricyclo[10.4.0.02,7]hexadeca-3,5,10,13,15-pentaene.
| Compound Name | (10Z)-8-azatricyclo[10.4.0.02,7]hexadeca-3,5,10,13,15-pentaene |
|---|---|
| PubChem CID | 22397616 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (10Z)-8-azatricyclo[10.4.0.02,7]hexadeca-3,5,10,13,15-pentaene |
| SMILES | C1=CC2/C=C\CNC3C=CC=CC3C2C=C1 |
| InChI | InChI=1S/C15H17N/c1-2-8-13-12(6-1)7-5-11-16-15-10-4-3-9-14(13)15/h1-10,12-16H,11H2/b7-5- |
| InChIKey | JVYSYXXZPCNXQD-ALCCZGGFSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|