About 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine
5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine (PubChem CID 22397660) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine.
Molecular Properties
| Compound Name | 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine |
| PubChem CID | 22397660 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine |
| SMILES | C1=CC2=c3ccccc3=CNNC2C=C1 |
| InChI | InChI=1S/C13H12N2/c1-2-6-11-10(5-1)9-14-15-13-8-4-3-7-12(11)13/h1-9,13-15H |
| InChIKey | QYONZVOTFKIKBE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine?
The IUPAC name of 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine (CID 22397660) is 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine.
What is the SMILES notation for 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine?
The canonical SMILES for 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine is C1=CC2=c3ccccc3=CNNC2C=C1.
What is the InChIKey of 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine?
The InChIKey is QYONZVOTFKIKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-6-11-10(5-1)9-14-15-13-8-4-3-7-12(11)13/h1-9,13-15H.
What are the key properties of 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine?
5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine has a molecular weight of 196.25 g/mol, XLogP of 0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4aH-benzo[d][2,3]benzodiazepine is sourced from PubChem (CID 22397660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).