C13H13N — CID 22397680
1,2,10,10a-tetrahydroacridine (PubChem CID 22397680) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 1,2,10,10a-tetrahydroacridine.
| Compound Name | 1,2,10,10a-tetrahydroacridine |
|---|---|
| PubChem CID | 22397680 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1,2,10,10a-tetrahydroacridine |
| SMILES | C1=CC2=CC3=C(C=CCC3)NC2C=C1 |
| InChI | InChI=1S/C13H13N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1,3-5,7-9,12,14H,2,6H2 |
| InChIKey | QDEWGUZOIFPEAZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |