C25H29N5O2 — CID 22398240
5-[(2,3,5,6-tetramethylphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide (PubChem CID 22398240) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 5-[(2,3,5,6-tetramethylphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide.
| Compound Name | 5-[(2,3,5,6-tetramethylphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22398240 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 5-[(2,3,5,6-tetramethylphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide |
| SMILES | Cc1cc(C)c(C)c(Cc2ccc(C(=O)NNc3cc(C)c4c(C)nn(C)c4n3)o2)c1C |
| InChI | InChI=1S/C25H29N5O2/c1-13-10-14(2)17(5)20(16(13)4)12-19-8-9-21(32-19)25(31)28-27-22-11-15(3)23-18(6)29-30(7)24(23)26-22/h8-11H,12H2,1-7H3,(H,26,27)(H,28,31) |
| InChIKey | BPHZQZRQPAELFQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|