About 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine
4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine (PubChem CID 22398445) has the molecular formula C11H8Cl3N3
and a molecular weight of 288.57 g/mol. Its IUPAC name is 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine |
| PubChem CID | 22398445 |
| Molecular Formula | C11H8Cl3N3 |
| Molecular Weight | 288.57 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C11H8Cl3N3/c12-8-2-1-3-9(13)7(8)4-6-5-10(14)17-11(15)16-6/h1-3,5H,4H2,(H2,15,16,17) |
| InChIKey | WOVVGQDOZWGNBF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine?
The IUPAC name of 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine (CID 22398445) is 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine.
What is the SMILES notation for 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine?
The canonical SMILES for 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine is Nc1nc(Cl)cc(Cc2c(Cl)cccc2Cl)n1.
What is the InChIKey of 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine?
The InChIKey is WOVVGQDOZWGNBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl3N3/c12-8-2-1-3-9(13)7(8)4-6-5-10(14)17-11(15)16-6/h1-3,5H,4H2,(H2,15,16,17).
What are the key properties of 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine?
4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine has a molecular weight of 288.57 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-amine is sourced from PubChem (CID 22398445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).