About 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol
1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol (PubChem CID 22398636) has the molecular formula C21H28FNO2
and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol |
| PubChem CID | 22398636 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(C)(O)Cc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C21H28FNO2/c1-14-9-15(2)23-17(10-14)12-21(5,24)13-20(3,4)18-11-16(22)7-8-19(18)25-6/h7-11,24H,12-13H2,1-6H3 |
| InChIKey | TVOAGKIOKRSKGA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol?
The IUPAC name of 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol (CID 22398636) is 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol?
The canonical SMILES for 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol is COc1ccc(F)cc1C(C)(C)CC(C)(O)Cc1cc(C)cc(C)n1.
What is the InChIKey of 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol?
The InChIKey is TVOAGKIOKRSKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28FNO2/c1-14-9-15(2)23-17(10-14)12-21(5,24)13-20(3,4)18-11-16(22)7-8-19(18)25-6/h7-11,24H,12-13H2,1-6H3.
What are the key properties of 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol?
1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol has a molecular weight of 345.46 g/mol, XLogP of 4.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethyl-2-pyridinyl)-4-(5-fluoro-2-methoxyphenyl)-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 22398636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).