C12H22N2O2 — CID 2239912
N'-(furan-2-ylmethyl)-N'-(3-methoxypropyl)propane-1,3-diamine (PubChem CID 2239912) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N'-(3-methoxypropyl)propane-1,3-diamine.
| Compound Name | N'-(furan-2-ylmethyl)-N'-(3-methoxypropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 2239912 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N'-(3-methoxypropyl)propane-1,3-diamine |
| SMILES | COCCCN(CCCN)Cc1ccco1 |
| InChI | InChI=1S/C12H22N2O2/c1-15-9-4-8-14(7-3-6-13)11-12-5-2-10-16-12/h2,5,10H,3-4,6-9,11,13H2,1H3 |
| InChIKey | NNEIPPGWCDZOCN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|