C22H22N2O4 — CID 22399450
2-[3-[1-(1H-indole-2-carbonyl)piperidin-4-yl]phenoxy]acetic acid (PubChem CID 22399450) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[3-[1-(1H-indole-2-carbonyl)piperidin-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[1-(1H-indole-2-carbonyl)piperidin-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 22399450 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[3-[1-(1H-indole-2-carbonyl)piperidin-4-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C2CCN(C(=O)c3cc4ccccc4[nH]3)CC2)c1 |
| InChI | InChI=1S/C22H22N2O4/c25-21(26)14-28-18-6-3-5-16(12-18)15-8-10-24(11-9-15)22(27)20-13-17-4-1-2-7-19(17)23-20/h1-7,12-13,15,23H,8-11,14H2,(H,25,26) |
| InChIKey | SEKPVZGNMSHGQU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |