About 2-methanidyl-N,N-dimethylaniline;titanium(3+)
2-methanidyl-N,N-dimethylaniline;titanium(3+) (PubChem CID 22399653) has the molecular formula C9H12NTi+2
and a molecular weight of 182.07 g/mol. Its IUPAC name is 2-methanidyl-N,N-dimethylaniline;titanium(3+).
Molecular Properties
| Compound Name | 2-methanidyl-N,N-dimethylaniline;titanium(3+) |
| PubChem CID | 22399653 |
| Molecular Formula | C9H12NTi+2 |
| Molecular Weight | 182.07 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2-methanidyl-N,N-dimethylaniline;titanium(3+) |
| SMILES | [CH2-]c1ccccc1N(C)C.[Ti+3] |
| InChI | InChI=1S/C9H12N.Ti/c1-8-6-4-5-7-9(8)10(2)3;/h4-7H,1H2,2-3H3;/q-1;+3 |
| InChIKey | IJQOFSKVQGKVKQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.07 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidyl-N,N-dimethylaniline;titanium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidyl-N,N-dimethylaniline;titanium(3+)?
The IUPAC name of 2-methanidyl-N,N-dimethylaniline;titanium(3+) (CID 22399653) is 2-methanidyl-N,N-dimethylaniline;titanium(3+).
What is the SMILES notation for 2-methanidyl-N,N-dimethylaniline;titanium(3+)?
The canonical SMILES for 2-methanidyl-N,N-dimethylaniline;titanium(3+) is [CH2-]c1ccccc1N(C)C.[Ti+3].
What is the InChIKey of 2-methanidyl-N,N-dimethylaniline;titanium(3+)?
The InChIKey is IJQOFSKVQGKVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.Ti/c1-8-6-4-5-7-9(8)10(2)3;/h4-7H,1H2,2-3H3;/q-1;+3.
What are the key properties of 2-methanidyl-N,N-dimethylaniline;titanium(3+)?
2-methanidyl-N,N-dimethylaniline;titanium(3+) has a molecular weight of 182.07 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidyl-N,N-dimethylaniline;titanium(3+) is sourced from PubChem (CID 22399653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).