About benzyl(triethyl)azanium;2,2,2-trifluoroacetate
benzyl(triethyl)azanium;2,2,2-trifluoroacetate (PubChem CID 22399837) has the molecular formula C15H22F3NO2
and a molecular weight of 305.34 g/mol. Its IUPAC name is benzyl(triethyl)azanium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | benzyl(triethyl)azanium;2,2,2-trifluoroacetate |
| PubChem CID | 22399837 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | benzyl(triethyl)azanium;2,2,2-trifluoroacetate |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H22N.C2HF3O2/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;3-2(4,5)1(6)7/h7-11H,4-6,12H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | PARJTQLCRDGFCD-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triethyl)azanium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triethyl)azanium;2,2,2-trifluoroacetate?
The IUPAC name of benzyl(triethyl)azanium;2,2,2-trifluoroacetate (CID 22399837) is benzyl(triethyl)azanium;2,2,2-trifluoroacetate.
What is the SMILES notation for benzyl(triethyl)azanium;2,2,2-trifluoroacetate?
The canonical SMILES for benzyl(triethyl)azanium;2,2,2-trifluoroacetate is CC[N+](CC)(CC)Cc1ccccc1.O=C([O-])C(F)(F)F.
What is the InChIKey of benzyl(triethyl)azanium;2,2,2-trifluoroacetate?
The InChIKey is PARJTQLCRDGFCD-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H22N.C2HF3O2/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;3-2(4,5)1(6)7/h7-11H,4-6,12H2,1-3H3;(H,6,7)/q+1;/p-1.
What are the key properties of benzyl(triethyl)azanium;2,2,2-trifluoroacetate?
benzyl(triethyl)azanium;2,2,2-trifluoroacetate has a molecular weight of 305.34 g/mol, XLogP of 2.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triethyl)azanium;2,2,2-trifluoroacetate is sourced from PubChem (CID 22399837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).