1-ethenyl-1,2-dimethylimidazol-1-ium chloride

C7H11ClN2 — CID 22400013

IUPAC1-ethenyl-1,2-dimethylimidazol-1-ium chloride
SMILESC=C[N+]1(C)C=CN=C1C.[Cl-]
InChIInChI=1S/C7H11N2.ClH/c1-4-9(3)6-5-8-7(9)2;/h4-6H,1H2,2-3H3;1H/q+1;/p-1
InChIKeyXWDVXBJBQUCGKP-UHFFFAOYSA-M
MW158.63 g/mol
LogP-1.52
Rot. Bonds1

About 1-ethenyl-1,2-dimethylimidazol-1-ium chloride

1-ethenyl-1,2-dimethylimidazol-1-ium chloride (PubChem CID 22400013) has the molecular formula C7H11ClN2 and a molecular weight of 158.63 g/mol. Its IUPAC name is 1-ethenyl-1,2-dimethylimidazol-1-ium chloride.

Molecular Properties

Compound Name1-ethenyl-1,2-dimethylimidazol-1-ium chloride
PubChem CID22400013
Molecular FormulaC7H11ClN2
Molecular Weight158.63 g/mol
Exact Mass158.06
IUPAC Name1-ethenyl-1,2-dimethylimidazol-1-ium chloride
SMILESC=C[N+]1(C)C=CN=C1C.[Cl-]
InChIInChI=1S/C7H11N2.ClH/c1-4-9(3)6-5-8-7(9)2;/h4-6H,1H2,2-3H3;1H/q+1;/p-1
InChIKeyXWDVXBJBQUCGKP-UHFFFAOYSA-M
XLogP-1.52
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.63
LogP ≤ 5-1.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1-ethenyl-1,2-dimethylimidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethenyl-1,2-dimethylimidazol-1-ium chloride?
The IUPAC name of 1-ethenyl-1,2-dimethylimidazol-1-ium chloride (CID 22400013) is 1-ethenyl-1,2-dimethylimidazol-1-ium chloride.
What is the SMILES notation for 1-ethenyl-1,2-dimethylimidazol-1-ium chloride?
The canonical SMILES for 1-ethenyl-1,2-dimethylimidazol-1-ium chloride is C=C[N+]1(C)C=CN=C1C.[Cl-].
What is the InChIKey of 1-ethenyl-1,2-dimethylimidazol-1-ium chloride?
The InChIKey is XWDVXBJBQUCGKP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H11N2.ClH/c1-4-9(3)6-5-8-7(9)2;/h4-6H,1H2,2-3H3;1H/q+1;/p-1.
What are the key properties of 1-ethenyl-1,2-dimethylimidazol-1-ium chloride?
1-ethenyl-1,2-dimethylimidazol-1-ium chloride has a molecular weight of 158.63 g/mol, XLogP of -1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1,2-dimethylimidazol-1-ium chloride is sourced from PubChem (CID 22400013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).