C10H5F11O2 — CID 22400638
methyl 2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate (PubChem CID 22400638) has the molecular formula C10H5F11O2 and a molecular weight of 366.13 g/mol. Its IUPAC name is methyl 2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate.
| Compound Name | methyl 2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate |
|---|---|
| PubChem CID | 22400638 |
| Molecular Formula | C10H5F11O2 |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | methyl 2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H5F11O2/c1-3(4(22)23-2)5(11)6(12,13)8(16,17)10(20,21)9(18,19)7(5,14)15/h1H2,2H3 |
| InChIKey | NNZPCILWXXGHKL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|