C18H28O7 — CID 22400641
3,6-dimethylbenzene-1,2-diol;(3-hydroxy-2,2-dimethylpropanoyl) 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 22400641) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3,6-dimethylbenzene-1,2-diol;(3-hydroxy-2,2-dimethylpropanoyl) 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | 3,6-dimethylbenzene-1,2-diol;(3-hydroxy-2,2-dimethylpropanoyl) 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22400641 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 3,6-dimethylbenzene-1,2-diol;(3-hydroxy-2,2-dimethylpropanoyl) 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | CC(C)(CO)C(=O)OC(=O)C(C)(C)CO.Cc1ccc(C)c(O)c1O |
| InChI | InChI=1S/C10H18O5.C8H10O2/c1-9(2,5-11)7(13)15-8(14)10(3,4)6-12;1-5-3-4-6(2)8(10)7(5)9/h11-12H,5-6H2,1-4H3;3-4,9-10H,1-2H3 |
| InChIKey | FDBZWRFSSGCCLA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|