C22H22IN3O2 — CID 2240067
N-cyclohexyl-4-iodo-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide (PubChem CID 2240067) has the molecular formula C22H22IN3O2 and a molecular weight of 487.34 g/mol. Its IUPAC name is N-cyclohexyl-4-iodo-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide.
| Compound Name | N-cyclohexyl-4-iodo-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 2240067 |
| Molecular Formula | C22H22IN3O2 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | N-cyclohexyl-4-iodo-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzamide |
| SMILES | O=C(c1ccc(I)cc1)N(Cc1nc(-c2ccccc2)no1)C1CCCCC1 |
| InChI | InChI=1S/C22H22IN3O2/c23-18-13-11-17(12-14-18)22(27)26(19-9-5-2-6-10-19)15-20-24-21(25-28-20)16-7-3-1-4-8-16/h1,3-4,7-8,11-14,19H,2,5-6,9-10,15H2 |
| InChIKey | PXLBCIILRWFLTJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|