C13H16N2 — CID 22400724
1,2,3,4,8,10-hexahydroacridin-9-amine (PubChem CID 22400724) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1,2,3,4,8,10-hexahydroacridin-9-amine.
| Compound Name | 1,2,3,4,8,10-hexahydroacridin-9-amine |
|---|---|
| PubChem CID | 22400724 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1,2,3,4,8,10-hexahydroacridin-9-amine |
| SMILES | NC1=C2CC=CC=C2NC2=C1CCCC2 |
| InChI | InChI=1S/C13H16N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,7,15H,2,4-6,8,14H2 |
| InChIKey | CSTLYPJYISYAIG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |