About methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate
methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate (PubChem CID 22400852) has the molecular formula C23H18Cl2O2
and a molecular weight of 397.30 g/mol. Its IUPAC name is methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate |
| PubChem CID | 22400852 |
| Molecular Formula | C23H18Cl2O2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=C/c1ccccc1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2O2/c1-27-23(26)20-9-5-4-7-18(20)12-11-17-6-2-3-8-19(17)14-16-10-13-21(24)22(25)15-16/h2-13,15H,14H2,1H3/b12-11+ |
| InChIKey | SYHSDOUQWZTQJS-VAWYXSNFSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate?
The IUPAC name of methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate (CID 22400852) is methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate.
What is the SMILES notation for methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate?
The canonical SMILES for methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate is COC(=O)c1ccccc1/C=C/c1ccccc1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate?
The InChIKey is SYHSDOUQWZTQJS-VAWYXSNFSA-N. The full InChI is InChI=1S/C23H18Cl2O2/c1-27-23(26)20-9-5-4-7-18(20)12-11-17-6-2-3-8-19(17)14-16-10-13-21(24)22(25)15-16/h2-13,15H,14H2,1H3/b12-11+.
What are the key properties of methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate?
methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate has a molecular weight of 397.30 g/mol, XLogP of 6.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(E)-2-[2-[(3,4-dichlorophenyl)methyl]phenyl]ethenyl]benzoate is sourced from PubChem (CID 22400852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).