methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate

C12H14N4O2 — CID 22400939

IUPACmethyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate
SMILESCOC(=O)Cn1nnnc1-c1cc(C)cc(C)c1
InChIInChI=1S/C12H14N4O2/c1-8-4-9(2)6-10(5-8)12-13-14-15-16(12)7-11(17)18-3/h4-6H,7H2,1-3H3
InChIKeyUEBRSWDJXCNHQV-UHFFFAOYSA-N
MW246.27 g/mol
LogP1.13
Rot. Bonds3

About methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate

methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate (PubChem CID 22400939) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate
PubChem CID22400939
Molecular FormulaC12H14N4O2
Molecular Weight246.27 g/mol
Exact Mass246.11
IUPAC Namemethyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate
SMILESCOC(=O)Cn1nnnc1-c1cc(C)cc(C)c1
InChIInChI=1S/C12H14N4O2/c1-8-4-9(2)6-10(5-8)12-13-14-15-16(12)7-11(17)18-3/h4-6H,7H2,1-3H3
InChIKeyUEBRSWDJXCNHQV-UHFFFAOYSA-N
XLogP1.13
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 51.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate?
The IUPAC name of methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate (CID 22400939) is methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate?
The canonical SMILES for methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate is COC(=O)Cn1nnnc1-c1cc(C)cc(C)c1.
What is the InChIKey of methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate?
The InChIKey is UEBRSWDJXCNHQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-8-4-9(2)6-10(5-8)12-13-14-15-16(12)7-11(17)18-3/h4-6H,7H2,1-3H3.
What are the key properties of methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate?
methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate has a molecular weight of 246.27 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate is sourced from PubChem (CID 22400939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).