C12H14N4O2 — CID 22400939
methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate (PubChem CID 22400939) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate.
| Compound Name | methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate |
|---|---|
| PubChem CID | 22400939 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | methyl 2-[5-(3,5-dimethylphenyl)tetrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1nnnc1-c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H14N4O2/c1-8-4-9(2)6-10(5-8)12-13-14-15-16(12)7-11(17)18-3/h4-6H,7H2,1-3H3 |
| InChIKey | UEBRSWDJXCNHQV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |