C10H11N5O2S — CID 22401670
N-(6-methyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl)acetamide (PubChem CID 22401670) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is N-(6-methyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl)acetamide.
| Compound Name | N-(6-methyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 22401670 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(6-methyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl)acetamide |
| SMILES | CC(=O)Nc1nn(C)c2nc3n(c(=O)c12)CCS3 |
| InChI | InChI=1S/C10H11N5O2S/c1-5(16)11-7-6-8(14(2)13-7)12-10-15(9(6)17)3-4-18-10/h3-4H2,1-2H3,(H,11,13,16) |
| InChIKey | AKWZOYYZVPFURN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |