C11H15N5OS — CID 22401703
4-amino-5-tert-butyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one (PubChem CID 22401703) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-amino-5-tert-butyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one.
| Compound Name | 4-amino-5-tert-butyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one |
|---|---|
| PubChem CID | 22401703 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-amino-5-tert-butyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-trien-2-one |
| SMILES | CC(C)(C)n1nc2nc3n(c(=O)c2c1N)CCS3 |
| InChI | InChI=1S/C11H15N5OS/c1-11(2,3)16-7(12)6-8(14-16)13-10-15(9(6)17)4-5-18-10/h4-5,12H2,1-3H3 |
| InChIKey | QCQMYSZSKVZZAZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |