C12H15N5O3S — CID 22401707
tert-butyl 4-amino-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-triene-5-carboxylate (PubChem CID 22401707) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is tert-butyl 4-amino-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-triene-5-carboxylate.
| Compound Name | tert-butyl 4-amino-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 22401707 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | tert-butyl 4-amino-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3,6,8-triene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc2nc3n(c(=O)c2c1N)CCS3 |
| InChI | InChI=1S/C12H15N5O3S/c1-12(2,3)20-11(19)17-7(13)6-8(15-17)14-10-16(9(6)18)4-5-21-10/h4-5,13H2,1-3H3 |
| InChIKey | JOKDGADNTQDRNF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |