About N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide
N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide (PubChem CID 22402381) has the molecular formula C21H32N4O3
and a molecular weight of 388.51 g/mol. Its IUPAC name is N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide |
| PubChem CID | 22402381 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide |
| SMILES | CCCn1c(N)c(NC(=O)C23CC4CC(CC(C4)C2)C3)c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C21H32N4O3/c1-3-5-24-17(22)16(18(26)25(6-4-2)20(24)28)23-19(27)21-10-13-7-14(11-21)9-15(8-13)12-21/h13-15H,3-12,22H2,1-2H3,(H,23,27) |
| InChIKey | QRBZZPIESDDUGD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide?
The IUPAC name of N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide (CID 22402381) is N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide.
What is the SMILES notation for N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide?
The canonical SMILES for N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide is CCCn1c(N)c(NC(=O)C23CC4CC(CC(C4)C2)C3)c(=O)n(CCC)c1=O.
What is the InChIKey of N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide?
The InChIKey is QRBZZPIESDDUGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N4O3/c1-3-5-24-17(22)16(18(26)25(6-4-2)20(24)28)23-19(27)21-10-13-7-14(11-21)9-15(8-13)12-21/h13-15H,3-12,22H2,1-2H3,(H,23,27).
What are the key properties of N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide?
N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide has a molecular weight of 388.51 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)adamantane-1-carboxamide is sourced from PubChem (CID 22402381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).