About N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide
N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide (PubChem CID 22402491) has the molecular formula C14H18FN3O
and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide |
| PubChem CID | 22402491 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1CNN=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN3O/c1-9(2)7-13(19)17-12-8-16-18-14(12)10-3-5-11(15)6-4-10/h3-6,9,12,16H,7-8H2,1-2H3,(H,17,19) |
| InChIKey | RLCXUDVTCFNDLU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide?
The IUPAC name of N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide (CID 22402491) is N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide.
What is the SMILES notation for N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide?
The canonical SMILES for N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide is CC(C)CC(=O)NC1CNN=C1c1ccc(F)cc1.
What is the InChIKey of N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide?
The InChIKey is RLCXUDVTCFNDLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN3O/c1-9(2)7-13(19)17-12-8-16-18-14(12)10-3-5-11(15)6-4-10/h3-6,9,12,16H,7-8H2,1-2H3,(H,17,19).
What are the key properties of N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide?
N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide has a molecular weight of 263.32 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-fluorophenyl)-4,5-dihydro-1H-pyrazol-4-yl]-3-methylbutanamide is sourced from PubChem (CID 22402491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).