About O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate
O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate (PubChem CID 22402892) has the molecular formula C24H20F3NO4S2
and a molecular weight of 507.56 g/mol. Its IUPAC name is O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate |
| PubChem CID | 22402892 |
| Molecular Formula | C24H20F3NO4S2 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate |
| SMILES | Cc1cccc(C)c1OC(=S)c1c2ccccc2[n+](C)c2ccccc12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H20NOS.CHF3O3S/c1-15-9-8-10-16(2)22(15)25-23(26)21-17-11-4-6-13-19(17)24(3)20-14-7-5-12-18(20)21;2-1(3,4)8(5,6)7/h4-14H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MRQKMXKQARCHCJ-UHFFFAOYSA-M |
| XLogP | 5.24 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate?
The IUPAC name of O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate (CID 22402892) is O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate.
What is the SMILES notation for O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate?
The canonical SMILES for O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate is Cc1cccc(C)c1OC(=S)c1c2ccccc2[n+](C)c2ccccc12.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate?
The InChIKey is MRQKMXKQARCHCJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H20NOS.CHF3O3S/c1-15-9-8-10-16(2)22(15)25-23(26)21-17-11-4-6-13-19(17)24(3)20-14-7-5-12-18(20)21;2-1(3,4)8(5,6)7/h4-14H,1-3H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate?
O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate has a molecular weight of 507.56 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2,6-dimethylphenyl) 10-methylacridin-10-ium-9-carbothioate;trifluoromethanesulfonate is sourced from PubChem (CID 22402892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).