C13H9N3OS — CID 22403366
N-phenyl-1,2,3-benzothiadiazole-7-carboxamide (PubChem CID 22403366) has the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. Its IUPAC name is N-phenyl-1,2,3-benzothiadiazole-7-carboxamide.
| Compound Name | N-phenyl-1,2,3-benzothiadiazole-7-carboxamide |
|---|---|
| PubChem CID | 22403366 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-phenyl-1,2,3-benzothiadiazole-7-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cccc2nnsc12 |
| InChI | InChI=1S/C13H9N3OS/c17-13(14-9-5-2-1-3-6-9)10-7-4-8-11-12(10)18-16-15-11/h1-8H,(H,14,17) |
| InChIKey | XPMFKVHJSXPOEN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |