About 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol
5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 22403480) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol.
Molecular Properties
| Compound Name | 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol |
| PubChem CID | 22403480 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | COc1cc2c(c(C)c1O)OCC2 |
| InChI | InChI=1S/C10H12O3/c1-6-9(11)8(12-2)5-7-3-4-13-10(6)7/h5,11H,3-4H2,1-2H3 |
| InChIKey | ASAKKQIVHWINRG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol?
The IUPAC name of 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol (CID 22403480) is 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol.
What is the SMILES notation for 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol?
The canonical SMILES for 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol is COc1cc2c(c(C)c1O)OCC2.
What is the InChIKey of 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol?
The InChIKey is ASAKKQIVHWINRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-9(11)8(12-2)5-7-3-4-13-10(6)7/h5,11H,3-4H2,1-2H3.
What are the key properties of 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol?
5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol has a molecular weight of 180.20 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-7-methyl-2,3-dihydro-1-benzofuran-6-ol is sourced from PubChem (CID 22403480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).