About dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate
dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate (PubChem CID 22403537) has the molecular formula C14H25NO7S
and a molecular weight of 351.42 g/mol. Its IUPAC name is dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate.
Molecular Properties
| Compound Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate |
| PubChem CID | 22403537 |
| Molecular Formula | C14H25NO7S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)[O-].C=C(C)C(=O)OCC[NH+](C)C |
| InChI | InChI=1S/C8H15NO2.C6H10O5S/c1-7(2)8(10)11-6-5-9(3)4;1-5(2)6(7)11-3-4-12(8,9)10/h1,5-6H2,2-4H3;1,3-4H2,2H3,(H,8,9,10) |
| InChIKey | OSGICGWJSWODPY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate?
The IUPAC name of dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate (CID 22403537) is dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate.
What is the SMILES notation for dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate?
The canonical SMILES for dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate is C=C(C)C(=O)OCCS(=O)(=O)[O-].C=C(C)C(=O)OCC[NH+](C)C.
What is the InChIKey of dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate?
The InChIKey is OSGICGWJSWODPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H10O5S/c1-7(2)8(10)11-6-5-9(3)4;1-5(2)6(7)11-3-4-12(8,9)10/h1,5-6H2,2-4H3;1,3-4H2,2H3,(H,8,9,10).
What are the key properties of dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate?
dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate has a molecular weight of 351.42 g/mol, XLogP of -1.10, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-(2-methylprop-2-enoyloxy)ethanesulfonate is sourced from PubChem (CID 22403537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).