About 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea
1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea (PubChem CID 22403852) has the molecular formula C13H16N6O5
and a molecular weight of 336.31 g/mol. Its IUPAC name is 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea.
Molecular Properties
| Compound Name | 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea |
| PubChem CID | 22403852 |
| Molecular Formula | C13H16N6O5 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea |
| SMILES | COc1cc(OC)nc(NC(=O)Nc2nc(OC)cc(OC)n2)n1 |
| InChI | InChI=1S/C13H16N6O5/c1-21-7-5-8(22-2)15-11(14-7)18-13(20)19-12-16-9(23-3)6-10(17-12)24-4/h5-6H,1-4H3,(H2,14,15,16,17,18,19,20) |
| InChIKey | KJTOWNISNRFWFN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea?
The IUPAC name of 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea (CID 22403852) is 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea.
What is the SMILES notation for 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea?
The canonical SMILES for 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea is COc1cc(OC)nc(NC(=O)Nc2nc(OC)cc(OC)n2)n1.
What is the InChIKey of 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea?
The InChIKey is KJTOWNISNRFWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N6O5/c1-21-7-5-8(22-2)15-11(14-7)18-13(20)19-12-16-9(23-3)6-10(17-12)24-4/h5-6H,1-4H3,(H2,14,15,16,17,18,19,20).
What are the key properties of 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea?
1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea has a molecular weight of 336.31 g/mol, XLogP of 0.94, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4,6-dimethoxypyrimidin-2-yl)urea is sourced from PubChem (CID 22403852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).