About CID 22404112
CID 22404112 (PubChem CID 22404112) has the molecular formula C11H13BrFSi
and a molecular weight of 272.21 g/mol.
Molecular Properties
| Compound Name | CID 22404112 |
| PubChem CID | 22404112 |
| Molecular Formula | C11H13BrFSi |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | — |
| SMILES | Fc1ccc(C2CC[Si](Br)CC2)cc1 |
| InChI | InChI=1S/C11H13BrFSi/c12-14-7-5-10(6-8-14)9-1-3-11(13)4-2-9/h1-4,10H,5-8H2 |
| InChIKey | IAPKKRBFTMBQNG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 22404112 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22404112?
The IUPAC name of CID 22404112 (CID 22404112) is not available.
What is the SMILES notation for CID 22404112?
The canonical SMILES for CID 22404112 is Fc1ccc(C2CC[Si](Br)CC2)cc1.
What is the InChIKey of CID 22404112?
The InChIKey is IAPKKRBFTMBQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrFSi/c12-14-7-5-10(6-8-14)9-1-3-11(13)4-2-9/h1-4,10H,5-8H2.
What are the key properties of CID 22404112?
CID 22404112 has a molecular weight of 272.21 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22404112 is sourced from PubChem (CID 22404112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).