C11H18O — CID 22404510
(6E,8E)-undeca-6,8,10-trien-4-ol (PubChem CID 22404510) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (6E,8E)-undeca-6,8,10-trien-4-ol.
| Compound Name | (6E,8E)-undeca-6,8,10-trien-4-ol |
|---|---|
| PubChem CID | 22404510 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (6E,8E)-undeca-6,8,10-trien-4-ol |
| SMILES | C=C/C=C/C=C/CC(O)CCC |
| InChI | InChI=1S/C11H18O/c1-3-5-6-7-8-10-11(12)9-4-2/h3,5-8,11-12H,1,4,9-10H2,2H3/b6-5+,8-7+ |
| InChIKey | YAWVREQAXOUSRY-BSWSSELBSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|